About CID 101224795
CID 101224795 (PubChem CID 101224795) has the molecular formula C13H7O2
and a molecular weight of 195.20 g/mol.
Molecular Properties
| Compound Name | CID 101224795 |
| PubChem CID | 101224795 |
| Molecular Formula | C13H7O2 |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | — |
| SMILES | [O]c1ccc2cccc3c2c1C=CC3=O |
| InChI | InChI=1S/C13H7O2/c14-11-6-4-8-2-1-3-9-12(15)7-5-10(11)13(8)9/h1-7H |
| InChIKey | XAEWCNDZNBEUFO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 101224795 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101224795?
The IUPAC name of CID 101224795 (CID 101224795) is not available.
What is the SMILES notation for CID 101224795?
The canonical SMILES for CID 101224795 is [O]c1ccc2cccc3c2c1C=CC3=O.
What is the InChIKey of CID 101224795?
The InChIKey is XAEWCNDZNBEUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7O2/c14-11-6-4-8-2-1-3-9-12(15)7-5-10(11)13(8)9/h1-7H.
What are the key properties of CID 101224795?
CID 101224795 has a molecular weight of 195.20 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101224795 is sourced from PubChem (CID 101224795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).