About azane;phenalen-1-one
azane;phenalen-1-one (PubChem CID 175328338) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is azane;phenalen-1-one.
Molecular Properties
| Compound Name | azane;phenalen-1-one |
| PubChem CID | 175328338 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | azane;phenalen-1-one |
| SMILES | N.O=C1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H8O.H3N/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10;/h1-8H;1H3 |
| InChIKey | UTMCCKOGIZRPTB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;phenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phenalen-1-one?
The IUPAC name of azane;phenalen-1-one (CID 175328338) is azane;phenalen-1-one.
What is the SMILES notation for azane;phenalen-1-one?
The canonical SMILES for azane;phenalen-1-one is N.O=C1C=Cc2cccc3cccc1c23.
What is the InChIKey of azane;phenalen-1-one?
The InChIKey is UTMCCKOGIZRPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.H3N/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10;/h1-8H;1H3.
What are the key properties of azane;phenalen-1-one?
azane;phenalen-1-one has a molecular weight of 197.24 g/mol, XLogP of 3.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phenalen-1-one is sourced from PubChem (CID 175328338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).