C13H8O4 — CID 1042814
2,2-dihydroxyphenalene-1,3-dione (PubChem CID 1042814) has the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2,2-dihydroxyphenalene-1,3-dione.
| Compound Name | 2,2-dihydroxyphenalene-1,3-dione |
|---|---|
| PubChem CID | 1042814 |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2,2-dihydroxyphenalene-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)C1(O)O |
| InChI | InChI=1S/C13H8O4/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13(11,16)17/h1-6,16-17H |
| InChIKey | JYCIBUOSCBHKCM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|