C24H14O8 — CID 59435063
5-[3-(2,2-dihydroxy-1,3-dioxoinden-5-yl)phenyl]-2,2-dihydroxyindene-1,3-dione (PubChem CID 59435063) has the molecular formula C24H14O8 and a molecular weight of 430.37 g/mol. Its IUPAC name is 5-[3-(2,2-dihydroxy-1,3-dioxoinden-5-yl)phenyl]-2,2-dihydroxyindene-1,3-dione.
| Compound Name | 5-[3-(2,2-dihydroxy-1,3-dioxoinden-5-yl)phenyl]-2,2-dihydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 59435063 |
| Molecular Formula | C24H14O8 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 5-[3-(2,2-dihydroxy-1,3-dioxoinden-5-yl)phenyl]-2,2-dihydroxyindene-1,3-dione |
| SMILES | O=C1c2ccc(-c3cccc(-c4ccc5c(c4)C(=O)C(O)(O)C5=O)c3)cc2C(=O)C1(O)O |
| InChI | InChI=1S/C24H14O8/c25-19-15-6-4-13(9-17(15)21(27)23(19,29)30)11-2-1-3-12(8-11)14-5-7-16-18(10-14)22(28)24(31,32)20(16)26/h1-10,29-32H |
| InChIKey | YTZVOYUOIQSHEK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|