C19H13NO2S — CID 175019617
5-[3-(2-methylthiophen-3-yl)phenyl]isoindole-1,3-dione (PubChem CID 175019617) has the molecular formula C19H13NO2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 5-[3-(2-methylthiophen-3-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-[3-(2-methylthiophen-3-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175019617 |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 5-[3-(2-methylthiophen-3-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1sccc1-c1cccc(-c2ccc3c(c2)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C19H13NO2S/c1-11-15(7-8-23-11)14-4-2-3-12(9-14)13-5-6-16-17(10-13)19(22)20-18(16)21/h2-10H,1H3,(H,20,21,22) |
| InChIKey | MKTNACIYZRKOHD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|