C14H11NO2 — CID 175436163
3-hydroxy-5-phenyl-2,3-dihydroisoindol-1-one (PubChem CID 175436163) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-hydroxy-5-phenyl-2,3-dihydroisoindol-1-one.
| Compound Name | 3-hydroxy-5-phenyl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 175436163 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-hydroxy-5-phenyl-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(O)c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C14H11NO2/c16-13-11-7-6-10(8-12(11)14(17)15-13)9-4-2-1-3-5-9/h1-8,14,17H,(H,15,16) |
| InChIKey | BOKOMKRISUKDCH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |