C36H29NO3S — CID 177280300
1-(4-phenylmethoxyphenyl)sulfanyl-5-(4-propan-2-ylanilino)anthracene-9,10-dione (PubChem CID 177280300) has the molecular formula C36H29NO3S and a molecular weight of 555.70 g/mol. Its IUPAC name is 1-(4-phenylmethoxyphenyl)sulfanyl-5-(4-propan-2-ylanilino)anthracene-9,10-dione.
| Compound Name | 1-(4-phenylmethoxyphenyl)sulfanyl-5-(4-propan-2-ylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 177280300 |
| Molecular Formula | C36H29NO3S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 1-(4-phenylmethoxyphenyl)sulfanyl-5-(4-propan-2-ylanilino)anthracene-9,10-dione |
| SMILES | CC(C)c1ccc(Nc2cccc3c2C(=O)c2cccc(Sc4ccc(OCc5ccccc5)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C36H29NO3S/c1-23(2)25-14-16-26(17-15-25)37-31-12-6-10-29-33(31)35(38)30-11-7-13-32(34(30)36(29)39)41-28-20-18-27(19-21-28)40-22-24-8-4-3-5-9-24/h3-21,23,37H,22H2,1-2H3 |
| InChIKey | CRKLNZUNABNVFM-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|