C25H24N2O2 — CID 151870924
1-[4-(aminomethyl)-2,6-diethylanilino]anthracene-9,10-dione (PubChem CID 151870924) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-2,6-diethylanilino]anthracene-9,10-dione.
| Compound Name | 1-[4-(aminomethyl)-2,6-diethylanilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 151870924 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[4-(aminomethyl)-2,6-diethylanilino]anthracene-9,10-dione |
| SMILES | CCc1cc(CN)cc(CC)c1Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H24N2O2/c1-3-16-12-15(14-26)13-17(4-2)23(16)27-21-11-7-10-20-22(21)25(29)19-9-6-5-8-18(19)24(20)28/h5-13,27H,3-4,14,26H2,1-2H3 |
| InChIKey | SMQYNLBYULRSFI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|