C35H35IN2O2 — CID 142521055
1-(2,6-diethyl-4-iodoanilino)-4-(2,6-diethyl-4-methylanilino)anthracene-9,10-dione (PubChem CID 142521055) has the molecular formula C35H35IN2O2 and a molecular weight of 642.58 g/mol. Its IUPAC name is 1-(2,6-diethyl-4-iodoanilino)-4-(2,6-diethyl-4-methylanilino)anthracene-9,10-dione.
| Compound Name | 1-(2,6-diethyl-4-iodoanilino)-4-(2,6-diethyl-4-methylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 142521055 |
| Molecular Formula | C35H35IN2O2 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | 1-(2,6-diethyl-4-iodoanilino)-4-(2,6-diethyl-4-methylanilino)anthracene-9,10-dione |
| SMILES | CCc1cc(C)cc(CC)c1Nc1ccc(Nc2c(CC)cc(I)cc2CC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C35H35IN2O2/c1-6-21-16-20(5)17-22(7-2)32(21)37-28-14-15-29(38-33-23(8-3)18-25(36)19-24(33)9-4)31-30(28)34(39)26-12-10-11-13-27(26)35(31)40/h10-19,37-38H,6-9H2,1-5H3 |
| InChIKey | ZJSJDPIWOYPONZ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|