C44H50N2O2S2 — CID 118288679
1,4-bis(4-hept-1-en-2-ylsulfanyl-2,6-dimethylanilino)anthracene-9,10-dione (PubChem CID 118288679) has the molecular formula C44H50N2O2S2 and a molecular weight of 703.03 g/mol. Its IUPAC name is 1,4-bis(4-hept-1-en-2-ylsulfanyl-2,6-dimethylanilino)anthracene-9,10-dione.
| Compound Name | 1,4-bis(4-hept-1-en-2-ylsulfanyl-2,6-dimethylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 118288679 |
| Molecular Formula | C44H50N2O2S2 |
| Molecular Weight | 703.03 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | 1,4-bis(4-hept-1-en-2-ylsulfanyl-2,6-dimethylanilino)anthracene-9,10-dione |
| SMILES | C=C(CCCCC)Sc1cc(C)c(Nc2ccc(Nc3c(C)cc(SC(=C)CCCCC)cc3C)c3c2C(=O)c2ccccc2C3=O)c(C)c1 |
| InChI | InChI=1S/C44H50N2O2S2/c1-9-11-13-17-31(7)49-33-23-27(3)41(28(4)24-33)45-37-21-22-38(40-39(37)43(47)35-19-15-16-20-36(35)44(40)48)46-42-29(5)25-34(26-30(42)6)50-32(8)18-14-12-10-2/h15-16,19-26,45-46H,7-14,17-18H2,1-6H3 |
| InChIKey | GPNQPSBBFUQCSR-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.03 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|