C37H38N2O6S — CID 160611745
1-amino-2-[4-(2-methyl-4-methylidenehexan-2-yl)phenoxy]-4-(2,4,6-trimethylanilino)anthracene-9,10-dione;sulfur trioxide (PubChem CID 160611745) has the molecular formula C37H38N2O6S and a molecular weight of 638.79 g/mol. Its IUPAC name is 1-amino-2-[4-(2-methyl-4-methylidenehexan-2-yl)phenoxy]-4-(2,4,6-trimethylanilino)anthracene-9,10-dione;sulfur trioxide.
| Compound Name | 1-amino-2-[4-(2-methyl-4-methylidenehexan-2-yl)phenoxy]-4-(2,4,6-trimethylanilino)anthracene-9,10-dione;sulfur trioxide |
|---|---|
| PubChem CID | 160611745 |
| Molecular Formula | C37H38N2O6S |
| Molecular Weight | 638.79 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 1-amino-2-[4-(2-methyl-4-methylidenehexan-2-yl)phenoxy]-4-(2,4,6-trimethylanilino)anthracene-9,10-dione;sulfur trioxide |
| SMILES | C=C(CC)CC(C)(C)c1ccc(Oc2cc(Nc3c(C)cc(C)cc3C)c3c(c2N)C(=O)c2ccccc2C3=O)cc1.O=S(=O)=O |
| InChI | InChI=1S/C37H38N2O3.O3S/c1-8-21(2)20-37(6,7)25-13-15-26(16-14-25)42-30-19-29(39-34-23(4)17-22(3)18-24(34)5)31-32(33(30)38)36(41)28-12-10-9-11-27(28)35(31)40;1-4(2)3/h9-19,39H,2,8,20,38H2,1,3-7H3; |
| InChIKey | RFOQTJAQFFDGOO-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|