C33H31ClN2O5S — CID 87330415
3-[[4-amino-3-(4-tert-butylphenoxy)-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonyl chloride (PubChem CID 87330415) has the molecular formula C33H31ClN2O5S and a molecular weight of 603.14 g/mol. Its IUPAC name is 3-[[4-amino-3-(4-tert-butylphenoxy)-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonyl chloride.
| Compound Name | 3-[[4-amino-3-(4-tert-butylphenoxy)-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 87330415 |
| Molecular Formula | C33H31ClN2O5S |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 3-[[4-amino-3-(4-tert-butylphenoxy)-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1Nc1cc(Oc2ccc(C(C)(C)C)cc2)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C33H31ClN2O5S/c1-17-15-18(2)32(42(34,39)40)19(3)29(17)36-24-16-25(41-21-13-11-20(12-14-21)33(4,5)6)28(35)27-26(24)30(37)22-9-7-8-10-23(22)31(27)38/h7-16,36H,35H2,1-6H3 |
| InChIKey | CVLFMFXFLTYOJT-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|