C37H36N2O3 — CID 142048527
10-anilino-16-methyl-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione (PubChem CID 142048527) has the molecular formula C37H36N2O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is 10-anilino-16-methyl-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione.
| Compound Name | 10-anilino-16-methyl-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
|---|---|
| PubChem CID | 142048527 |
| Molecular Formula | C37H36N2O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 10-anilino-16-methyl-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
| SMILES | Cc1c2c3c(c(Nc4ccccc4)cc(Oc4ccc(C(C)(C)CC(C)(C)C)cc4)c3[nH]c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C37H36N2O3/c1-22-30-26-14-10-11-15-27(26)34(40)31-28(38-24-12-8-7-9-13-24)20-29(33(32(30)31)39-35(22)41)42-25-18-16-23(17-19-25)37(5,6)21-36(2,3)4/h7-20,38H,21H2,1-6H3,(H,39,41) |
| InChIKey | ULFIZIGGYMLCBC-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|