C37H33N3O3 — CID 21039466
10-anilino-16-isocyano-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione (PubChem CID 21039466) has the molecular formula C37H33N3O3 and a molecular weight of 567.69 g/mol. Its IUPAC name is 10-anilino-16-isocyano-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione.
| Compound Name | 10-anilino-16-isocyano-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
|---|---|
| PubChem CID | 21039466 |
| Molecular Formula | C37H33N3O3 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 10-anilino-16-isocyano-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
| SMILES | [C-]#[N+]c1c2c3c(c(Nc4ccccc4)cc(Oc4ccc(C(C)(C)CC(C)(C)C)cc4)c3[nH]c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C37H33N3O3/c1-36(2,3)21-37(4,5)22-16-18-24(19-17-22)43-28-20-27(39-23-12-8-7-9-13-23)30-31-29(33(38-6)35(42)40-32(28)31)25-14-10-11-15-26(25)34(30)41/h7-20,39H,21H2,1-5H3,(H,40,42) |
| InChIKey | WTKJXHDCTYIAHI-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|