C48H52N2O2 — CID 91226367
10-anilino-15-(4-tert-butylphenyl)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;ethane (PubChem CID 91226367) has the molecular formula C48H52N2O2 and a molecular weight of 688.96 g/mol. Its IUPAC name is 10-anilino-15-(4-tert-butylphenyl)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;ethane.
| Compound Name | 10-anilino-15-(4-tert-butylphenyl)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;ethane |
|---|---|
| PubChem CID | 91226367 |
| Molecular Formula | C48H52N2O2 |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.40 |
| IUPAC Name | 10-anilino-15-(4-tert-butylphenyl)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one;ethane |
| SMILES | CC.CC(C)(C)CC(C)(C)c1ccc(Oc2cc(Nc3ccccc3)c3c4c(cc(-c5ccc(C(C)(C)C)cc5)nc24)-c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C46H46N2O2.C2H6/c1-44(2,3)28-46(7,8)31-22-24-33(25-23-31)50-39-27-38(47-32-14-10-9-11-15-32)41-40-36(34-16-12-13-17-35(34)43(41)49)26-37(48-42(39)40)29-18-20-30(21-19-29)45(4,5)6;1-2/h9-27,47H,28H2,1-8H3;1-2H3 |
| InChIKey | MPIDDIXYDBTAKX-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|