C32H27N3O2 — CID 163498463
6-anilino-2-(4-tert-butylphenyl)-4-methoxybenzo[e]perimidin-7-one (PubChem CID 163498463) has the molecular formula C32H27N3O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 6-anilino-2-(4-tert-butylphenyl)-4-methoxybenzo[e]perimidin-7-one.
| Compound Name | 6-anilino-2-(4-tert-butylphenyl)-4-methoxybenzo[e]perimidin-7-one |
|---|---|
| PubChem CID | 163498463 |
| Molecular Formula | C32H27N3O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 6-anilino-2-(4-tert-butylphenyl)-4-methoxybenzo[e]perimidin-7-one |
| SMILES | COc1cc(Nc2ccccc2)c2c3c(nc(-c4ccc(C(C)(C)C)cc4)nc13)-c1ccccc1C2=O |
| InChI | InChI=1S/C32H27N3O2/c1-32(2,3)20-16-14-19(15-17-20)31-34-28-22-12-8-9-13-23(22)30(36)26-24(33-21-10-6-5-7-11-21)18-25(37-4)29(35-31)27(26)28/h5-18,33H,1-4H3 |
| InChIKey | CSRSXRPBZUSFPA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|