C36H29N3O4 — CID 136660174
6-anilino-2-(2-hydroxy-4-methoxyphenyl)-4-phenoxybenzo[e]perimidin-7-one;ethane (PubChem CID 136660174) has the molecular formula C36H29N3O4 and a molecular weight of 567.65 g/mol. Its IUPAC name is 6-anilino-2-(2-hydroxy-4-methoxyphenyl)-4-phenoxybenzo[e]perimidin-7-one;ethane.
| Compound Name | 6-anilino-2-(2-hydroxy-4-methoxyphenyl)-4-phenoxybenzo[e]perimidin-7-one;ethane |
|---|---|
| PubChem CID | 136660174 |
| Molecular Formula | C36H29N3O4 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 6-anilino-2-(2-hydroxy-4-methoxyphenyl)-4-phenoxybenzo[e]perimidin-7-one;ethane |
| SMILES | CC.COc1ccc(-c2nc3c4c(c(Nc5ccccc5)cc(Oc5ccccc5)c4n2)C(=O)c2ccccc2-3)c(O)c1 |
| InChI | InChI=1S/C34H23N3O4.C2H6/c1-40-22-16-17-25(27(38)18-22)34-36-31-23-14-8-9-15-24(23)33(39)29-26(35-20-10-4-2-5-11-20)19-28(32(37-34)30(29)31)41-21-12-6-3-7-13-21;1-2/h2-19,35,38H,1H3;1-2H3 |
| InChIKey | CZRYQEBZEXDUBD-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|