C39H36N4O7S — CID 91250599
N-[4,5-dimethoxy-2-[6-(4-methoxyanilino)-7-oxo-4-phenoxybenzo[e]perimidin-2-yl]phenyl]methanesulfonamide;ethane (PubChem CID 91250599) has the molecular formula C39H36N4O7S and a molecular weight of 704.81 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-[6-(4-methoxyanilino)-7-oxo-4-phenoxybenzo[e]perimidin-2-yl]phenyl]methanesulfonamide;ethane.
| Compound Name | N-[4,5-dimethoxy-2-[6-(4-methoxyanilino)-7-oxo-4-phenoxybenzo[e]perimidin-2-yl]phenyl]methanesulfonamide;ethane |
|---|---|
| PubChem CID | 91250599 |
| Molecular Formula | C39H36N4O7S |
| Molecular Weight | 704.81 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | N-[4,5-dimethoxy-2-[6-(4-methoxyanilino)-7-oxo-4-phenoxybenzo[e]perimidin-2-yl]phenyl]methanesulfonamide;ethane |
| SMILES | CC.COc1ccc(Nc2cc(Oc3ccccc3)c3nc(-c4cc(OC)c(OC)cc4NS(C)(=O)=O)nc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C37H30N4O7S.C2H6/c1-45-22-16-14-21(15-17-22)38-28-20-31(48-23-10-6-5-7-11-23)35-33-32(28)36(42)25-13-9-8-12-24(25)34(33)39-37(40-35)26-18-29(46-2)30(47-3)19-27(26)41-49(4,43)44;1-2/h5-20,38,41H,1-4H3;1-2H3 |
| InChIKey | ODYOBGUKZJNGQU-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.81 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|