C25H23N3O — CID 91513884
6-anilino-2,4-dimethylbenzo[e]perimidin-7-one;ethane (PubChem CID 91513884) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 6-anilino-2,4-dimethylbenzo[e]perimidin-7-one;ethane.
| Compound Name | 6-anilino-2,4-dimethylbenzo[e]perimidin-7-one;ethane |
|---|---|
| PubChem CID | 91513884 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 6-anilino-2,4-dimethylbenzo[e]perimidin-7-one;ethane |
| SMILES | CC.Cc1nc2c3c(c(Nc4ccccc4)cc(C)c3n1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H17N3O.C2H6/c1-13-12-18(26-15-8-4-3-5-9-15)19-20-21(13)24-14(2)25-22(20)16-10-6-7-11-17(16)23(19)27;1-2/h3-12,26H,1-2H3;1-2H3 |
| InChIKey | FHJXUSNRQAMWOY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|