C34H32N2O3 — CID 136617365
6-(4-tert-butylphenoxy)-2-(2-hydroxyphenyl)-4-methylbenzo[e]perimidin-7-one;ethane (PubChem CID 136617365) has the molecular formula C34H32N2O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 6-(4-tert-butylphenoxy)-2-(2-hydroxyphenyl)-4-methylbenzo[e]perimidin-7-one;ethane.
| Compound Name | 6-(4-tert-butylphenoxy)-2-(2-hydroxyphenyl)-4-methylbenzo[e]perimidin-7-one;ethane |
|---|---|
| PubChem CID | 136617365 |
| Molecular Formula | C34H32N2O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 6-(4-tert-butylphenoxy)-2-(2-hydroxyphenyl)-4-methylbenzo[e]perimidin-7-one;ethane |
| SMILES | CC.Cc1cc(Oc2ccc(C(C)(C)C)cc2)c2c3c(nc(-c4ccccc4O)nc13)-c1ccccc1C2=O |
| InChI | InChI=1S/C32H26N2O3.C2H6/c1-18-17-25(37-20-15-13-19(14-16-20)32(2,3)4)26-27-28(18)33-31(23-11-7-8-12-24(23)35)34-29(27)21-9-5-6-10-22(21)30(26)36;1-2/h5-17,35H,1-4H3;1-2H3 |
| InChIKey | CUNINLWMKYFZDS-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |