C45H46N2O4 — CID 136658624
ethane;15-(2-hydroxyphenyl)-10-(4-methoxyanilino)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one (PubChem CID 136658624) has the molecular formula C45H46N2O4 and a molecular weight of 678.87 g/mol. Its IUPAC name is ethane;15-(2-hydroxyphenyl)-10-(4-methoxyanilino)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one.
| Compound Name | ethane;15-(2-hydroxyphenyl)-10-(4-methoxyanilino)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
|---|---|
| PubChem CID | 136658624 |
| Molecular Formula | C45H46N2O4 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | ethane;15-(2-hydroxyphenyl)-10-(4-methoxyanilino)-12-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
| SMILES | CC.COc1ccc(Nc2cc(Oc3ccc(C(C)(C)CC(C)(C)C)cc3)c3cc(-c4ccccc4O)nc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C43H40N2O4.C2H6/c1-42(2,3)25-43(4,5)26-15-19-29(20-16-26)49-37-24-35(44-27-17-21-28(48-6)22-18-27)39-38-33(37)23-34(32-13-9-10-14-36(32)46)45-40(38)30-11-7-8-12-31(30)41(39)47;1-2/h7-24,44,46H,25H2,1-6H3;1-2H3 |
| InChIKey | FAQKNZIHYTYPPP-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|