C23H16N2O — CID 20810791
6-anilino-15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one (PubChem CID 20810791) has the molecular formula C23H16N2O and a molecular weight of 336.39 g/mol. Its IUPAC name is 6-anilino-15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one.
| Compound Name | 6-anilino-15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one |
|---|---|
| PubChem CID | 20810791 |
| Molecular Formula | C23H16N2O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6-anilino-15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one |
| SMILES | Cc1cc2c3c(cccc3n1)C(=O)c1c(Nc3ccccc3)cccc1-2 |
| InChI | InChI=1S/C23H16N2O/c1-14-13-18-16-9-5-12-20(25-15-7-3-2-4-8-15)22(16)23(26)17-10-6-11-19(24-14)21(17)18/h2-13,25H,1H3 |
| InChIKey | SWRNNWNUAWACGO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|