C25H20N2O2 — CID 20810847
15-methyl-10-[(4-methylphenoxy)methylamino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one (PubChem CID 20810847) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 15-methyl-10-[(4-methylphenoxy)methylamino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one.
| Compound Name | 15-methyl-10-[(4-methylphenoxy)methylamino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
|---|---|
| PubChem CID | 20810847 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 15-methyl-10-[(4-methylphenoxy)methylamino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
| SMILES | Cc1ccc(OCNc2ccc3nc(C)cc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C25H20N2O2/c1-15-7-9-17(10-8-15)29-14-26-21-11-12-22-23-20(13-16(2)27-22)18-5-3-4-6-19(18)25(28)24(21)23/h3-13,26H,14H2,1-2H3 |
| InChIKey | ZIIMTCYQHOTMFW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|