C35H38N2O3 — CID 163613775
1-amino-4-anilino-2-[5-methyl-4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,3-dien-1-yl]oxyanthracene-9,10-dione (PubChem CID 163613775) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is 1-amino-4-anilino-2-[5-methyl-4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,3-dien-1-yl]oxyanthracene-9,10-dione.
| Compound Name | 1-amino-4-anilino-2-[5-methyl-4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,3-dien-1-yl]oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 163613775 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 1-amino-4-anilino-2-[5-methyl-4-(2,4,4-trimethylpentan-2-yl)cyclohexa-1,3-dien-1-yl]oxyanthracene-9,10-dione |
| SMILES | CC1CC(Oc2cc(Nc3ccccc3)c3c(c2N)C(=O)c2ccccc2C3=O)=CC=C1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C35H38N2O3/c1-21-18-23(16-17-26(21)35(5,6)20-34(2,3)4)40-28-19-27(37-22-12-8-7-9-13-22)29-30(31(28)36)33(39)25-15-11-10-14-24(25)32(29)38/h7-17,19,21,37H,18,20,36H2,1-6H3 |
| InChIKey | HIFGWLQRAGREEW-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|