C36H38N2O6 — CID 90192979
1,4-bis[4-(2-methoxyethoxy)-2,6-dimethylanilino]anthracene-9,10-dione (PubChem CID 90192979) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is 1,4-bis[4-(2-methoxyethoxy)-2,6-dimethylanilino]anthracene-9,10-dione.
| Compound Name | 1,4-bis[4-(2-methoxyethoxy)-2,6-dimethylanilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 90192979 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 1,4-bis[4-(2-methoxyethoxy)-2,6-dimethylanilino]anthracene-9,10-dione |
| SMILES | COCCOc1cc(C)c(Nc2ccc(Nc3c(C)cc(OCCOC)cc3C)c3c2C(=O)c2ccccc2C3=O)c(C)c1 |
| InChI | InChI=1S/C36H38N2O6/c1-21-17-25(43-15-13-41-5)18-22(2)33(21)37-29-11-12-30(32-31(29)35(39)27-9-7-8-10-28(27)36(32)40)38-34-23(3)19-26(20-24(34)4)44-16-14-42-6/h7-12,17-20,37-38H,13-16H2,1-6H3 |
| InChIKey | GNQZMCRTYIJFHD-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|