C25H22BrN2NaO5S — CID 140623537
sodium 1-amino-4-(2-bromo-4-butyl-6-methylanilino)-9,10-dioxoanthracene-2-sulfonate (PubChem CID 140623537) has the molecular formula C25H22BrN2NaO5S and a molecular weight of 565.42 g/mol. Its IUPAC name is sodium 1-amino-4-(2-bromo-4-butyl-6-methylanilino)-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | sodium 1-amino-4-(2-bromo-4-butyl-6-methylanilino)-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 140623537 |
| Molecular Formula | C25H22BrN2NaO5S |
| Molecular Weight | 565.42 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | sodium 1-amino-4-(2-bromo-4-butyl-6-methylanilino)-9,10-dioxoanthracene-2-sulfonate |
| SMILES | CCCCc1cc(C)c(Nc2cc(S(=O)(=O)[O-])c(N)c3c2C(=O)c2ccccc2C3=O)c(Br)c1.[Na+] |
| InChI | InChI=1S/C25H23BrN2O5S.Na/c1-3-4-7-14-10-13(2)23(17(26)11-14)28-18-12-19(34(31,32)33)22(27)21-20(18)24(29)15-8-5-6-9-16(15)25(21)30;/h5-6,8-12,28H,3-4,7,27H2,1-2H3,(H,31,32,33);/q;+1/p-1 |
| InChIKey | LTLKSJHBAVNUSU-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|