C43H58N4O7S2 — CID 91444846
1,4-bis(2,6-diethylanilino)anthracene-9,10-dione;N-ethyl-N-(2-hydroxyethyl)methanesulfonamide;N-ethyl-N-methylmethanesulfonamide (PubChem CID 91444846) has the molecular formula C43H58N4O7S2 and a molecular weight of 807.09 g/mol. Its IUPAC name is 1,4-bis(2,6-diethylanilino)anthracene-9,10-dione;N-ethyl-N-(2-hydroxyethyl)methanesulfonamide;N-ethyl-N-methylmethanesulfonamide.
| Compound Name | 1,4-bis(2,6-diethylanilino)anthracene-9,10-dione;N-ethyl-N-(2-hydroxyethyl)methanesulfonamide;N-ethyl-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 91444846 |
| Molecular Formula | C43H58N4O7S2 |
| Molecular Weight | 807.09 g/mol |
| Exact Mass | 806.37 |
| IUPAC Name | 1,4-bis(2,6-diethylanilino)anthracene-9,10-dione;N-ethyl-N-(2-hydroxyethyl)methanesulfonamide;N-ethyl-N-methylmethanesulfonamide |
| SMILES | CCN(C)S(C)(=O)=O.CCN(CCO)S(C)(=O)=O.CCc1cccc(CC)c1Nc1ccc(Nc2c(CC)cccc2CC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C34H34N2O2.C5H13NO3S.C4H11NO2S/c1-5-21-13-11-14-22(6-2)31(21)35-27-19-20-28(36-32-23(7-3)15-12-16-24(32)8-4)30-29(27)33(37)25-17-9-10-18-26(25)34(30)38;1-3-6(4-5-7)10(2,8)9;1-4-5(2)8(3,6)7/h9-20,35-36H,5-8H2,1-4H3;7H,3-5H2,1-2H3;4H2,1-3H3 |
| InChIKey | BYZVTAPLMUJWRU-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.09 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|