C38H34N2O6 — CID 163586130
2-[4-[[5-[4-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]-9,10-dioxoanthracen-1-yl]amino]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 163586130) has the molecular formula C38H34N2O6 and a molecular weight of 614.70 g/mol. Its IUPAC name is 2-[4-[[5-[4-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]-9,10-dioxoanthracen-1-yl]amino]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[[5-[4-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]-9,10-dioxoanthracen-1-yl]amino]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163586130 |
| Molecular Formula | C38H34N2O6 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | 2-[4-[[5-[4-[2-(2-methylprop-2-enoyloxy)ethyl]anilino]-9,10-dioxoanthracen-1-yl]amino]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(Nc2cccc3c2C(=O)c2cccc(Nc4ccc(CCOC(=O)C(=C)C)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C38H34N2O6/c1-23(2)37(43)45-21-19-25-11-15-27(16-12-25)39-31-9-5-7-29-33(31)35(41)30-8-6-10-32(34(30)36(29)42)40-28-17-13-26(14-18-28)20-22-46-38(44)24(3)4/h5-18,39-40H,1,3,19-22H2,2,4H3 |
| InChIKey | YMOGRUUUEQEQEQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|