C10H14N2O3S2 — CID 58709351
4-(dimethylcarbamothioylamino)-3-methylbenzenesulfonic acid (PubChem CID 58709351) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-(dimethylcarbamothioylamino)-3-methylbenzenesulfonic acid.
| Compound Name | 4-(dimethylcarbamothioylamino)-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58709351 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-(dimethylcarbamothioylamino)-3-methylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1NC(=S)N(C)C |
| InChI | InChI=1S/C10H14N2O3S2/c1-7-6-8(17(13,14)15)4-5-9(7)11-10(16)12(2)3/h4-6H,1-3H3,(H,11,16)(H,13,14,15) |
| InChIKey | BOYHBBZQOMIKDD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|