About 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene
3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene (PubChem CID 88814975) has the molecular formula C18H18N2O3S2
and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene.
Molecular Properties
| Compound Name | 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene |
| PubChem CID | 88814975 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1NC(N)=S.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C8H10N2O3S2/c1-2-6-10-8-4-3-7-9(10)5-1;1-5-2-3-6(15(11,12)13)4-7(5)10-8(9)14/h1-8H;2-4H,1H3,(H3,9,10,14)(H,11,12,13) |
| InChIKey | TXDOWGZCFAQBMM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene?
The IUPAC name of 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene (CID 88814975) is 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene.
What is the SMILES notation for 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene?
The canonical SMILES for 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene is Cc1ccc(S(=O)(=O)O)cc1NC(N)=S.c1ccc2ccccc2c1.
What is the InChIKey of 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene?
The InChIKey is TXDOWGZCFAQBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C8H10N2O3S2/c1-2-6-10-8-4-3-7-9(10)5-1;1-5-2-3-6(15(11,12)13)4-7(5)10-8(9)14/h1-8H;2-4H,1H3,(H3,9,10,14)(H,11,12,13).
What are the key properties of 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene?
3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene has a molecular weight of 374.49 g/mol, XLogP of 3.74, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(carbamothioylamino)-4-methylbenzenesulfonic acid;naphthalene is sourced from PubChem (CID 88814975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).