C8H10N2O3S2 — CID 169359913
2-(carbamothioylamino)-5-methylbenzenesulfonic acid (PubChem CID 169359913) has the molecular formula C8H10N2O3S2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(carbamothioylamino)-5-methylbenzenesulfonic acid.
| Compound Name | 2-(carbamothioylamino)-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 169359913 |
| Molecular Formula | C8H10N2O3S2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-(carbamothioylamino)-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(NC(N)=S)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H10N2O3S2/c1-5-2-3-6(10-8(9)14)7(4-5)15(11,12)13/h2-4H,1H3,(H3,9,10,14)(H,11,12,13) |
| InChIKey | ZGKVHXWWUDEQSP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|