C22H15NO3 — CID 161402375
N-(1,3-dioxo-7-phenylinden-4-yl)benzamide (PubChem CID 161402375) has the molecular formula C22H15NO3 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(1,3-dioxo-7-phenylinden-4-yl)benzamide.
| Compound Name | N-(1,3-dioxo-7-phenylinden-4-yl)benzamide |
|---|---|
| PubChem CID | 161402375 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-(1,3-dioxo-7-phenylinden-4-yl)benzamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)c2c1C(=O)CC2=O)c1ccccc1 |
| InChI | InChI=1S/C22H15NO3/c24-18-13-19(25)21-17(23-22(26)15-9-5-2-6-10-15)12-11-16(20(18)21)14-7-3-1-4-8-14/h1-12H,13H2,(H,23,26) |
| InChIKey | CPURGDIIIXXGQL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|