C20H15N3O2 — CID 122639225
N-(3-oxo-7-pyridin-3-yl-1,2-dihydroisoindol-4-yl)benzamide (PubChem CID 122639225) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-(3-oxo-7-pyridin-3-yl-1,2-dihydroisoindol-4-yl)benzamide.
| Compound Name | N-(3-oxo-7-pyridin-3-yl-1,2-dihydroisoindol-4-yl)benzamide |
|---|---|
| PubChem CID | 122639225 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(3-oxo-7-pyridin-3-yl-1,2-dihydroisoindol-4-yl)benzamide |
| SMILES | O=C(Nc1ccc(-c2cccnc2)c2c1C(=O)NC2)c1ccccc1 |
| InChI | InChI=1S/C20H15N3O2/c24-19(13-5-2-1-3-6-13)23-17-9-8-15(14-7-4-10-21-11-14)16-12-22-20(25)18(16)17/h1-11H,12H2,(H,22,25)(H,23,24) |
| InChIKey | JHNTWAGJJUKAFL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |