C22H15F3N2O2 — CID 122639255
N-[3-oxo-7-[4-(trifluoromethyl)phenyl]-1,2-dihydroisoindol-4-yl]benzamide (PubChem CID 122639255) has the molecular formula C22H15F3N2O2 and a molecular weight of 396.37 g/mol. Its IUPAC name is N-[3-oxo-7-[4-(trifluoromethyl)phenyl]-1,2-dihydroisoindol-4-yl]benzamide.
| Compound Name | N-[3-oxo-7-[4-(trifluoromethyl)phenyl]-1,2-dihydroisoindol-4-yl]benzamide |
|---|---|
| PubChem CID | 122639255 |
| Molecular Formula | C22H15F3N2O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-oxo-7-[4-(trifluoromethyl)phenyl]-1,2-dihydroisoindol-4-yl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ccc(C(F)(F)F)cc2)c2c1C(=O)NC2)c1ccccc1 |
| InChI | InChI=1S/C22H15F3N2O2/c23-22(24,25)15-8-6-13(7-9-15)16-10-11-18(19-17(16)12-26-21(19)29)27-20(28)14-4-2-1-3-5-14/h1-11H,12H2,(H,26,29)(H,27,28) |
| InChIKey | BOYOUDHQLXZKCU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |