C23H19NO2S — CID 162075474
3-methylsulfanyl-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide (PubChem CID 162075474) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-methylsulfanyl-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide.
| Compound Name | 3-methylsulfanyl-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide |
|---|---|
| PubChem CID | 162075474 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-methylsulfanyl-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide |
| SMILES | CSc1cccc(C(=O)Nc2ccc(-c3ccccc3)c3c2C(=O)CC3)c1 |
| InChI | InChI=1S/C23H19NO2S/c1-27-17-9-5-8-16(14-17)23(26)24-20-12-10-18(15-6-3-2-4-7-15)19-11-13-21(25)22(19)20/h2-10,12,14H,11,13H2,1H3,(H,24,26) |
| InChIKey | ZBQMHYBYIXGHNY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |