C23H19NO3 — CID 147732049
2-methoxy-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide (PubChem CID 147732049) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-methoxy-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide.
| Compound Name | 2-methoxy-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide |
|---|---|
| PubChem CID | 147732049 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-methoxy-N-(3-oxo-7-phenyl-1,2-dihydroinden-4-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(-c2ccccc2)c2c1C(=O)CC2 |
| InChI | InChI=1S/C23H19NO3/c1-27-21-10-6-5-9-18(21)23(26)24-19-13-11-16(15-7-3-2-4-8-15)17-12-14-20(25)22(17)19/h2-11,13H,12,14H2,1H3,(H,24,26) |
| InChIKey | GYPVIMUNUUWQAV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |