C24H21NO4 — CID 159920274
N-[7-(2,4-dimethoxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]benzamide (PubChem CID 159920274) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[7-(2,4-dimethoxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]benzamide.
| Compound Name | N-[7-(2,4-dimethoxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]benzamide |
|---|---|
| PubChem CID | 159920274 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[7-(2,4-dimethoxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]benzamide |
| SMILES | COc1ccc(-c2ccc(NC(=O)c3ccccc3)c3c2CCC3=O)c(OC)c1 |
| InChI | InChI=1S/C24H21NO4/c1-28-16-8-9-18(22(14-16)29-2)17-10-12-20(23-19(17)11-13-21(23)26)25-24(27)15-6-4-3-5-7-15/h3-10,12,14H,11,13H2,1-2H3,(H,25,27) |
| InChIKey | NYHOSGRHFAUTAI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |