C14H11NO4S — CID 102192592
1-(2-nitrophenyl)-1,4-dihydro-2,3λ4-benzoxathiine 3-oxide (PubChem CID 102192592) has the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-1,4-dihydro-2,3λ4-benzoxathiine 3-oxide.
| Compound Name | 1-(2-nitrophenyl)-1,4-dihydro-2,3λ4-benzoxathiine 3-oxide |
|---|---|
| PubChem CID | 102192592 |
| Molecular Formula | C14H11NO4S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-(2-nitrophenyl)-1,4-dihydro-2,3λ4-benzoxathiine 3-oxide |
| SMILES | O=[N+]([O-])c1ccccc1C1OS(=O)Cc2ccccc21 |
| InChI | InChI=1S/C14H11NO4S/c16-15(17)13-8-4-3-7-12(13)14-11-6-2-1-5-10(11)9-20(18)19-14/h1-8,14H,9H2 |
| InChIKey | VUSAFUYXXKQYKZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|