C10H11NO3S2 — CID 134994350
2-(2-nitrophenyl)-1,3-dithiane 1-oxide (PubChem CID 134994350) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1,3-dithiane 1-oxide.
| Compound Name | 2-(2-nitrophenyl)-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 134994350 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-(2-nitrophenyl)-1,3-dithiane 1-oxide |
| SMILES | O=[N+]([O-])c1ccccc1C1SCCCS1=O |
| InChI | InChI=1S/C10H11NO3S2/c12-11(13)9-5-2-1-4-8(9)10-15-6-3-7-16(10)14/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | ULEVJXVNPQSCTI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|