C20H17N3O2 — CID 90936802
3-benzylimino-4-(1H-indol-3-yl)-1-methylpyrrolidine-2,5-dione (PubChem CID 90936802) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-benzylimino-4-(1H-indol-3-yl)-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-benzylimino-4-(1H-indol-3-yl)-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 90936802 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-benzylimino-4-(1H-indol-3-yl)-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)/C(=N\Cc2ccccc2)C(c2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C20H17N3O2/c1-23-19(24)17(15-12-21-16-10-6-5-9-14(15)16)18(20(23)25)22-11-13-7-3-2-4-8-13/h2-10,12,17,21H,11H2,1H3/b22-18- |
| InChIKey | FPVFBRAWKAPDBF-PYCFMQQDSA-N |
| XLogP | 2.89 |
| TPSA | 65.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|