C21H39N7O — CID 18457159
(2S)-2-amino-3-(1H-indol-3-yl)propanamide;N,N'-bis(3-aminopropyl)butane-1,4-diamine (PubChem CID 18457159) has the molecular formula C21H39N7O and a molecular weight of 405.59 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanamide;N,N'-bis(3-aminopropyl)butane-1,4-diamine.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanamide;N,N'-bis(3-aminopropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 18457159 |
| Molecular Formula | C21H39N7O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanamide;N,N'-bis(3-aminopropyl)butane-1,4-diamine |
| SMILES | NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12.NCCCNCCCCNCCCN |
| InChI | InChI=1S/C11H13N3O.C10H26N4/c12-9(11(13)15)5-7-6-14-10-4-2-1-3-8(7)10;11-5-3-9-13-7-1-2-8-14-10-4-6-12/h1-4,6,9,14H,5,12H2,(H2,13,15);13-14H,1-12H2/t9-;/m0./s1 |
| InChIKey | YMQCPHHGQFUGKB-FVGYRXGTSA-N |
| XLogP | 0.17 |
| TPSA | 161.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|