About 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione
3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 10547472) has the molecular formula C21H17N3O4
and a molecular weight of 375.38 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| PubChem CID | 10547472 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(/C=N/C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C21H17N3O4/c1-27-16-8-7-12(9-17(16)28-2)10-23-19-18(20(25)24-21(19)26)14-11-22-15-6-4-3-5-13(14)15/h3-11,22H,1-2H3,(H,24,25,26)/b23-10+ |
| InChIKey | ASAXXSXYNLRVEK-AUEPDCJTSA-N |
| XLogP | 2.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione?
The IUPAC name of 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione (CID 10547472) is 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
What is the SMILES notation for 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione?
The canonical SMILES for 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione is COc1ccc(/C=N/C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)cc1OC.
What is the InChIKey of 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione?
The InChIKey is ASAXXSXYNLRVEK-AUEPDCJTSA-N. The full InChI is InChI=1S/C21H17N3O4/c1-27-16-8-7-12(9-17(16)28-2)10-23-19-18(20(25)24-21(19)26)14-11-22-15-6-4-3-5-13(14)15/h3-11,22H,1-2H3,(H,24,25,26)/b23-10+.
What are the key properties of 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione?
3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione has a molecular weight of 375.38 g/mol, XLogP of 2.67, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione is sourced from PubChem (CID 10547472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).