C22H19N3O5 — CID 10573330
3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 10573330) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10573330 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methylideneamino]-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3=C(/N=C/c4ccc(OC)c(OC)c4)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C22H19N3O5/c1-28-13-5-6-16-14(9-13)15(11-23-16)19-20(22(27)25-21(19)26)24-10-12-4-7-17(29-2)18(8-12)30-3/h4-11,23H,1-3H3,(H,25,26,27)/b24-10+ |
| InChIKey | DEDPHNBULYHQDR-YSURURNPSA-N |
| XLogP | 2.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|