C14H11N5O3 — CID 10661694
3-azido-4-(5-methoxy-1H-indol-3-yl)-1-methylpyrrole-2,5-dione (PubChem CID 10661694) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-azido-4-(5-methoxy-1H-indol-3-yl)-1-methylpyrrole-2,5-dione.
| Compound Name | 3-azido-4-(5-methoxy-1H-indol-3-yl)-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 10661694 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-azido-4-(5-methoxy-1H-indol-3-yl)-1-methylpyrrole-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3=C(N=[N+]=[N-])C(=O)N(C)C3=O)c2c1 |
| InChI | InChI=1S/C14H11N5O3/c1-19-13(20)11(12(14(19)21)17-18-15)9-6-16-10-4-3-7(22-2)5-8(9)10/h3-6,16H,1-2H3 |
| InChIKey | CLGCWTRWANUYKB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|