C24H24N4O4 — CID 134818183
3,6-bis(5-methoxy-1H-indol-3-yl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 134818183) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3,6-bis(5-methoxy-1H-indol-3-yl)-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | 3,6-bis(5-methoxy-1H-indol-3-yl)-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 134818183 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3,6-bis(5-methoxy-1H-indol-3-yl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3C(=O)N(C)C(c4c[nH]c5ccc(OC)cc45)C(=O)N3C)c2c1 |
| InChI | InChI=1S/C24H24N4O4/c1-27-21(17-11-25-19-7-5-13(31-3)9-15(17)19)24(30)28(2)22(23(27)29)18-12-26-20-8-6-14(32-4)10-16(18)20/h5-12,21-22,25-26H,1-4H3 |
| InChIKey | BVDMFIHAQIRQHA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |