C14H18N2O5 — CID 167471754
3-(5-methoxy-1H-indol-3-yl)-1-methylpyrrolidine-2,2,5,5-tetrol (PubChem CID 167471754) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-(5-methoxy-1H-indol-3-yl)-1-methylpyrrolidine-2,2,5,5-tetrol.
| Compound Name | 3-(5-methoxy-1H-indol-3-yl)-1-methylpyrrolidine-2,2,5,5-tetrol |
|---|---|
| PubChem CID | 167471754 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(5-methoxy-1H-indol-3-yl)-1-methylpyrrolidine-2,2,5,5-tetrol |
| SMILES | COc1ccc2[nH]cc(C3CC(O)(O)N(C)C3(O)O)c2c1 |
| InChI | InChI=1S/C14H18N2O5/c1-16-13(17,18)6-11(14(16,19)20)10-7-15-12-4-3-8(21-2)5-9(10)12/h3-5,7,11,15,17-20H,6H2,1-2H3 |
| InChIKey | ZYKCXBUPGOUSBU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|