C33H31N3O4 — CID 101149578
1-[(4-tert-butylphenyl)methyl]-3,4-bis(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 101149578) has the molecular formula C33H31N3O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3,4-bis(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3,4-bis(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 101149578 |
| Molecular Formula | C33H31N3O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3,4-bis(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3=C(c4c[nH]c5ccc(OC)cc45)C(=O)N(Cc4ccc(C(C)(C)C)cc4)C3=O)c2c1 |
| InChI | InChI=1S/C33H31N3O4/c1-33(2,3)20-8-6-19(7-9-20)18-36-31(37)29(25-16-34-27-12-10-21(39-4)14-23(25)27)30(32(36)38)26-17-35-28-13-11-22(40-5)15-24(26)28/h6-17,34-35H,18H2,1-5H3 |
| InChIKey | RYXDZIMWBAMUOT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 87.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|