C24H19F2N3O2 — CID 101149580
1-tert-butyl-3,4-bis(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 101149580) has the molecular formula C24H19F2N3O2 and a molecular weight of 419.43 g/mol. Its IUPAC name is 1-tert-butyl-3,4-bis(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-tert-butyl-3,4-bis(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 101149580 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-tert-butyl-3,4-bis(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)N1C(=O)C(c2c[nH]c3ccc(F)cc23)=C(c2c[nH]c3ccc(F)cc23)C1=O |
| InChI | InChI=1S/C24H19F2N3O2/c1-24(2,3)29-22(30)20(16-10-27-18-6-4-12(25)8-14(16)18)21(23(29)31)17-11-28-19-7-5-13(26)9-15(17)19/h4-11,27-28H,1-3H3 |
| InChIKey | YMHIGDJEUXXHMW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|