C20H10BrFN2O4 — CID 172640017
3-(5-bromo-1H-indol-3-yl)-4-(5-fluoro-1-benzofuran-3-yl)-1-hydroxypyrrole-2,5-dione (PubChem CID 172640017) has the molecular formula C20H10BrFN2O4 and a molecular weight of 441.21 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-4-(5-fluoro-1-benzofuran-3-yl)-1-hydroxypyrrole-2,5-dione.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-4-(5-fluoro-1-benzofuran-3-yl)-1-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 172640017 |
| Molecular Formula | C20H10BrFN2O4 |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-4-(5-fluoro-1-benzofuran-3-yl)-1-hydroxypyrrole-2,5-dione |
| SMILES | O=C1C(c2c[nH]c3ccc(Br)cc23)=C(c2coc3ccc(F)cc23)C(=O)N1O |
| InChI | InChI=1S/C20H10BrFN2O4/c21-9-1-3-15-11(5-9)13(7-23-15)17-18(20(26)24(27)19(17)25)14-8-28-16-4-2-10(22)6-12(14)16/h1-8,23,27H |
| InChIKey | AUGAWVUYVAJQIZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|