C16H10BrFN2O2 — CID 39849718
N-(3-bromophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 39849718) has the molecular formula C16H10BrFN2O2 and a molecular weight of 361.17 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 39849718 |
| Molecular Formula | C16H10BrFN2O2 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | N-(3-bromophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1c[nH]c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C16H10BrFN2O2/c17-9-2-1-3-11(6-9)20-16(22)13-8-19-14-5-4-10(18)7-12(14)15(13)21/h1-8H,(H,19,21)(H,20,22) |
| InChIKey | KPJHYVDWHAZOSH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |